Products 2827061-47-0
CAS 2827061-47-0 is the registry number for 20S Proteasome-IN-4. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
6-chloro-4-(2,3-difluoroanilino)-N-[(2R)-3-hydroxy-2-methoxypropyl]quinoline-2-carboxamide (CAS 2827061-47-0) is a chemical compound with the molecular formula C20H18ClF2N3O3 and a molecular weight of 421.8 g/mol. IUPAC name: 6-chloro-4-(2,3-difluoroanilino)-N-[(2R)-3-hydroxy-2-methoxypropyl]quinoline-2-carboxamide. InChIKey: NTOVJWIULULGGI-GFCCVEGCSA-N.
| Molecular formula | C20H18ClF2N3O3 |
|---|---|
| Molecular weight | 421.8 g/mol |
| IUPAC name | 6-chloro-4-(2,3-difluoroanilino)-N-[(2R)-3-hydroxy-2-methoxypropyl]quinoline-2-carboxamide |
| InChIKey | NTOVJWIULULGGI-GFCCVEGCSA-N |
| SMILES | CO[C@H](CNC(=O)C1=NC2=C(C=C(C=C2)Cl)C(=C1)NC3=C(C(=CC=C3)F)F)CO |
Computed by PubChem (NCBI)