CAS 282715-94-0 is the registry number for 2-(3,5-Dichloro-2-hydroxyphenyl)-benzo(h)quinoline-4-carboxylic Acid. Offered by: TRC. Available pack sizes: 250mg.
2-(3,5-dichloro-2-hydroxyphenyl)benzo[h]quinoline-4-carboxylic acid (CAS 282715-94-0) is a chemical compound with the molecular formula C20H11Cl2NO3 and a molecular weight of 384.2 g/mol. IUPAC name: 2-(3,5-dichloro-2-hydroxyphenyl)benzo[h]quinoline-4-carboxylic acid. InChIKey: DCUQQGKTQODKGA-UHFFFAOYSA-N.
| Molecular formula | C20H11Cl2NO3 |
|---|---|
| Molecular weight | 384.2 g/mol |
| IUPAC name | 2-(3,5-dichloro-2-hydroxyphenyl)benzo[h]quinoline-4-carboxylic acid |
| InChIKey | DCUQQGKTQODKGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2N=C(C=C3C(=O)O)C4=C(C(=CC(=C4)Cl)Cl)O |
Computed by PubChem (NCBI)