CAS 282726-49-2 is the registry number for Bzl-Val-Leu-anilide. Offered by: Creative Peptides. Available pack sizes: on request.
(2S)-2-[[(2S)-2-(benzylamino)-3-methylbutanoyl]amino]-4-methyl-N-phenylpentanamide (CAS 282726-49-2) is a chemical compound with the molecular formula C24H33N3O2 and a molecular weight of 395.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-(benzylamino)-3-methylbutanoyl]amino]-4-methyl-N-phenylpentanamide. InChIKey: NYKOMMOOZGKOPP-VXKWHMMOSA-N.
| Molecular formula | C24H33N3O2 |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-(benzylamino)-3-methylbutanoyl]amino]-4-methyl-N-phenylpentanamide |
| InChIKey | NYKOMMOOZGKOPP-VXKWHMMOSA-N |
| SMILES | CC(C)C[C@@H](C(=O)NC1=CC=CC=C1)NC(=O)[C@H](C(C)C)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)