CAS 282729-77-5 is the registry number for 3-(3,4-Dichlorophenyl)-2-sulfanyl-3,4-dihydroquinazolin-4-one. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-(3,4-dichlorophenyl)-2-sulfanylidene-1H-quinazolin-4-one (CAS 282729-77-5) is a chemical compound with the molecular formula C14H8Cl2N2OS and a molecular weight of 323.2 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)-2-sulfanylidene-1H-quinazolin-4-one. InChIKey: ZQWPQURIYITFBC-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2N2OS |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | 3-(3,4-dichlorophenyl)-2-sulfanylidene-1H-quinazolin-4-one |
| InChIKey | ZQWPQURIYITFBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C(=S)N2)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)