CAS 2828431-84-9 appears in our catalog under these names: 2-(Dimethylamino)acetaldehyde sodium hydrogensulfite, 97%, 2-(Dimethylamino)acetaldehyde sodium hydrogensulfite. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g.
Sodium;2-(dimethylamino)acetaldehyde;hydrogen sulfite (CAS 2828431-84-9) is a chemical compound with the molecular formula C4H10NNaO4S and a molecular weight of 191.18 g/mol. IUPAC name: sodium;2-(dimethylamino)acetaldehyde;hydrogen sulfite. InChIKey: OUEZAPAXLWTULI-UHFFFAOYSA-M.
| Molecular formula | C4H10NNaO4S |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | sodium;2-(dimethylamino)acetaldehyde;hydrogen sulfite |
| InChIKey | OUEZAPAXLWTULI-UHFFFAOYSA-M |
| SMILES | CN(C)CC=O.OS(=O)[O-].[Na+] |
Computed by PubChem (NCBI)