Products 2828438-13-5
CAS 2828438-13-5 is the registry number for rel-tert-Butyl ((3aS,6aR)-2-benzylhexahydrocyclopenta[c]pyrrol-3a(1H)-yl)carbamate, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl N-[(3aS,6aR)-2-benzyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]carbamate (CAS 2828438-13-5) is a chemical compound with the molecular formula C19H28N2O2 and a molecular weight of 316.4 g/mol. IUPAC name: tert-butyl N-[(3aS,6aR)-2-benzyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]carbamate. InChIKey: QQISWOIGHVRQGC-VQIMIIECSA-N.
| Molecular formula | C19H28N2O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | tert-butyl N-[(3aS,6aR)-2-benzyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]carbamate |
| InChIKey | QQISWOIGHVRQGC-VQIMIIECSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@]12CCC[C@@H]1CN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)