Products 2828438-65-7
CAS 2828438-65-7 is the registry number for (S)-4-Cyclohexyl-2-(6-cyclopropylpyridin-2-yl)-4,5-dihydrooxazole, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4S)-4-cyclohexyl-2-(6-cyclopropyl-2-pyridinyl)-4,5-dihydro-1,3-oxazole (CAS 2828438-65-7) is a chemical compound with the molecular formula C17H22N2O and a molecular weight of 270.37 g/mol. IUPAC name: (4S)-4-cyclohexyl-2-(6-cyclopropyl-2-pyridinyl)-4,5-dihydro-1,3-oxazole. InChIKey: SVUBITNGLQZFFJ-MRXNPFEDSA-N.
| Molecular formula | C17H22N2O |
|---|---|
| Molecular weight | 270.37 g/mol |
| IUPAC name | (4S)-4-cyclohexyl-2-(6-cyclopropyl-2-pyridinyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | SVUBITNGLQZFFJ-MRXNPFEDSA-N |
| SMILES | C1CCC(CC1)[C@H]2COC(=N2)C3=CC=CC(=N3)C4CC4 |
Computed by PubChem (NCBI)