CAS 2828438-83-9 is the registry number for (4S,5S)-2-(Benzo[b]thiophen-2-yl)-4,5-diphenyl-4,5-dihydrooxazole, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4S,5S)-2-(1-benzothiophen-2-yl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole (CAS 2828438-83-9) is a chemical compound with the molecular formula C23H17NOS and a molecular weight of 355.5 g/mol. IUPAC name: (4S,5S)-2-(1-benzothiophen-2-yl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole. InChIKey: VQJYTUADCWTVQR-VXKWHMMOSA-N.
| Molecular formula | C23H17NOS |
|---|---|
| Molecular weight | 355.5 g/mol |
| IUPAC name | (4S,5S)-2-(1-benzothiophen-2-yl)-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | VQJYTUADCWTVQR-VXKWHMMOSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]2[C@@H](OC(=N2)C3=CC4=CC=CC=C4S3)C5=CC=CC=C5 |
Computed by PubChem (NCBI)