CAS 2828439-34-3 appears in our catalog under these names: 4-Deschloro-4-hydroxy Ospemifene, (Z)-4-(4-(2-Hydroxyethoxy)phenyl)-3,4-diphenylbut-3-en-1-ol, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 250mg, 100mg, 1g.
(Z)-4-[4-(2-hydroxyethoxy)phenyl]-3,4-diphenylbut-3-en-1-ol (CAS 2828439-34-3) is a chemical compound with the molecular formula C24H24O3 and a molecular weight of 360.4 g/mol. IUPAC name: (Z)-4-[4-(2-hydroxyethoxy)phenyl]-3,4-diphenylbut-3-en-1-ol. InChIKey: TVFAHBSDGLUQOJ-VHXPQNKSSA-N.
| Molecular formula | C24H24O3 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | (Z)-4-[4-(2-hydroxyethoxy)phenyl]-3,4-diphenylbut-3-en-1-ol |
| InChIKey | TVFAHBSDGLUQOJ-VHXPQNKSSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C(/C2=CC=CC=C2)\C3=CC=C(C=C3)OCCO)/CCO |
Computed by PubChem (NCBI)