Products 2828439-47-8
CAS 2828439-47-8 is the registry number for tert-Butyl (5-(tert-butyl)-2-oxoindolin-3-yl)carbamate, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 50mg, 250mg, 100mg.
Tert-butyl N-(5-tert-butyl-2-oxo-1,3-dihydroindol-3-yl)carbamate (CAS 2828439-47-8) is a chemical compound with the molecular formula C17H24N2O3 and a molecular weight of 304.4 g/mol. IUPAC name: tert-butyl N-(5-tert-butyl-2-oxo-1,3-dihydroindol-3-yl)carbamate. InChIKey: NEBLTGPSLHXSTQ-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O3 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | tert-butyl N-(5-tert-butyl-2-oxo-1,3-dihydroindol-3-yl)carbamate |
| InChIKey | NEBLTGPSLHXSTQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)NC(=O)C2NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)