CAS 2828440-03-3 is the registry number for (S)-2-Amino-2-(3,5-di-tert-butylphenyl)ethan-1-ol hydrochloride, 97%(HPLC),98%ee,RG, 97%(HPLC),98%ee,RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-2-(3,5-ditert-butylphenyl)ethanol;hydrochloride (CAS 2828440-03-3) is a chemical compound with the molecular formula C16H28ClNO and a molecular weight of 285.9 g/mol. IUPAC name: (2S)-2-amino-2-(3,5-ditert-butylphenyl)ethanol;hydrochloride. InChIKey: MCUJUTYYIDCRAA-PFEQFJNWSA-N.
| Molecular formula | C16H28ClNO |
|---|---|
| Molecular weight | 285.9 g/mol |
| IUPAC name | (2S)-2-amino-2-(3,5-ditert-butylphenyl)ethanol;hydrochloride |
| InChIKey | MCUJUTYYIDCRAA-PFEQFJNWSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)[C@@H](CO)N)C(C)(C)C.Cl |
Computed by PubChem (NCBI)