Products 2828444-30-8
CAS 2828444-30-8 is the registry number for (R)-4-Bromo-1-(pyrrolidin-3-yl)-1H-pyrazole hydrochloride, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
4-bromo-1-[(3R)-pyrrolidin-3-yl]pyrazole;hydrochloride (CAS 2828444-30-8) is a chemical compound with the molecular formula C7H11BrClN3 and a molecular weight of 252.54 g/mol. IUPAC name: 4-bromo-1-[(3R)-pyrrolidin-3-yl]pyrazole;hydrochloride. InChIKey: ZDMISNPPNOBORH-OGFXRTJISA-N.
| Molecular formula | C7H11BrClN3 |
|---|---|
| Molecular weight | 252.54 g/mol |
| IUPAC name | 4-bromo-1-[(3R)-pyrrolidin-3-yl]pyrazole;hydrochloride |
| InChIKey | ZDMISNPPNOBORH-OGFXRTJISA-N |
| SMILES | C1CNC[C@@H]1N2C=C(C=N2)Br.Cl |
Computed by PubChem (NCBI)