CAS 2828445-87-8 appears in our catalog under these names: (5-(2-(tert-Butoxycarbonyl)hydrazine-1-carbonyl)-2-fluorophenyl)boronic acid, 95%, 95%, (5-(2-(tert-Butoxycarbonyl)hydrazine-1-carbonyl)-2-fluorophenyl)boronic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
[2-fluoro-5-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]phenyl]boronic acid (CAS 2828445-87-8) is a chemical compound with the molecular formula C12H16BFN2O5 and a molecular weight of 298.08 g/mol. IUPAC name: [2-fluoro-5-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]phenyl]boronic acid. InChIKey: NDGPGUVEZBYEKT-UHFFFAOYSA-N.
| Molecular formula | C12H16BFN2O5 |
|---|---|
| Molecular weight | 298.08 g/mol |
| IUPAC name | [2-fluoro-5-[[(2-methylpropan-2-yl)oxycarbonylamino]carbamoyl]phenyl]boronic acid |
| InChIKey | NDGPGUVEZBYEKT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)NNC(=O)OC(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)