CAS 2828446-46-2 appears in our catalog under these names: 2-(3-Butoxy-2-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(3-Butoxy-2-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 25g, 250mg, 1g, 5g.
2-(3-butoxy-2-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2828446-46-2) is a chemical compound with the molecular formula C16H24BClO3 and a molecular weight of 310.6 g/mol. IUPAC name: 2-(3-butoxy-2-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZOBAOGZKOSXARX-UHFFFAOYSA-N.
| Molecular formula | C16H24BClO3 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | 2-(3-butoxy-2-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZOBAOGZKOSXARX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)OCCCC)Cl |
Computed by PubChem (NCBI)