Products 2828446-56-4
CAS 2828446-56-4 is the registry number for N-Ethyl-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.
N-ethyl-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 2828446-56-4) is a chemical compound with the molecular formula C15H21BFNO3 and a molecular weight of 293.14 g/mol. IUPAC name: N-ethyl-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: SNTRTULBEYHRRW-UHFFFAOYSA-N.
| Molecular formula | C15H21BFNO3 |
|---|---|
| Molecular weight | 293.14 g/mol |
| IUPAC name | N-ethyl-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | SNTRTULBEYHRRW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)C(=O)NCC |
Computed by PubChem (NCBI)