CAS 2828446-71-3 appears in our catalog under these names: Sodium 2-ethylhexyl sulfate hydrate 40% in water, Sodium 2-ethylhexyl sulfate hydrate, 40% in water, 40% in water. Offered by: Ambeed, Chemat. Available pack sizes: 1000g, 25g, 100g, 500g, 1kg.
Sodium;2-ethylhexyl sulfate;hydrate (CAS 2828446-71-3) is a chemical compound with the molecular formula C8H19NaO5S and a molecular weight of 250.29 g/mol. IUPAC name: sodium;2-ethylhexyl sulfate;hydrate. InChIKey: NTIXQJINVNYHTK-UHFFFAOYSA-M.
| Molecular formula | C8H19NaO5S |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | sodium;2-ethylhexyl sulfate;hydrate |
| InChIKey | NTIXQJINVNYHTK-UHFFFAOYSA-M |
| SMILES | CCCCC(CC)COS(=O)(=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)