Products 2828446-94-0
CAS 2828446-94-0 is the registry number for 3-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)propanamide, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide (CAS 2828446-94-0) is a chemical compound with the molecular formula C15H22BNO3 and a molecular weight of 275.15 g/mol. IUPAC name: 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide. InChIKey: SNHULAXDTVPOLH-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO3 |
|---|---|
| Molecular weight | 275.15 g/mol |
| IUPAC name | 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide |
| InChIKey | SNHULAXDTVPOLH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CCC(=O)N |
Computed by PubChem (NCBI)