Products 2828612-34-4
CAS 2828612-34-4 is the registry number for 1,3-DIBROMO-5-(TERT-BUTYL)-2-NITROBENZENE, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
1,3-dibromo-5-tert-butyl-2-nitrobenzene (CAS 2828612-34-4) is a chemical compound with the molecular formula C10H11Br2NO2 and a molecular weight of 337.01 g/mol. IUPAC name: 1,3-dibromo-5-tert-butyl-2-nitrobenzene. InChIKey: GZGSPJPWAAWBDG-UHFFFAOYSA-N.
| Molecular formula | C10H11Br2NO2 |
|---|---|
| Molecular weight | 337.01 g/mol |
| IUPAC name | 1,3-dibromo-5-tert-butyl-2-nitrobenzene |
| InChIKey | GZGSPJPWAAWBDG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)