CAS 2829292-63-7 is the registry number for (2S)-piperazine-2-carboxamide dihydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(2S)-piperazine-2-carboxamide;dihydrochloride (CAS 2829292-63-7) is a chemical compound with the molecular formula C5H13Cl2N3O and a molecular weight of 202.08 g/mol. IUPAC name: (2S)-piperazine-2-carboxamide;dihydrochloride. InChIKey: GQCNBEJAVIPVMY-FHNDMYTFSA-N.
| Molecular formula | C5H13Cl2N3O |
|---|---|
| Molecular weight | 202.08 g/mol |
| IUPAC name | (2S)-piperazine-2-carboxamide;dihydrochloride |
| InChIKey | GQCNBEJAVIPVMY-FHNDMYTFSA-N |
| SMILES | C1CN[C@@H](CN1)C(=O)N.Cl.Cl |
Computed by PubChem (NCBI)