Products 2829292-82-0
CAS 2829292-82-0 appears in our catalog under these names: δ9–THCP Acetate, Δ9-THCP acetate. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, Get quote.
[(6aR,10aR)-3-heptyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] acetate (CAS 2829292-82-0) is a chemical compound with the molecular formula C25H36O3 and a molecular weight of 384.6 g/mol. IUPAC name: [(6aR,10aR)-3-heptyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] acetate. InChIKey: OXMUZNKOOOITQD-NHCUHLMSSA-N.
| Molecular formula | C25H36O3 |
|---|---|
| Molecular weight | 384.6 g/mol |
| IUPAC name | [(6aR,10aR)-3-heptyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] acetate |
| InChIKey | OXMUZNKOOOITQD-NHCUHLMSSA-N |
| SMILES | CCCCCCCC1=CC2=C([C@@H]3C=C(CC[C@H]3C(O2)(C)C)C)C(=C1)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Delta9-THCP Acetate, | currency9-THCP acetate