Products 2829939-44-6
CAS 2829939-44-6 is the registry number for m-Se3. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(E)-2-(9-benzylcarbazol-3-yl)ethenyl]-3-methyl-1,3-benzoselenazol-3-ium iodide (CAS 2829939-44-6) is a chemical compound with the molecular formula C29H23IN2Se and a molecular weight of 605.4 g/mol. IUPAC name: 2-[(E)-2-(9-benzylcarbazol-3-yl)ethenyl]-3-methyl-1,3-benzoselenazol-3-ium iodide. InChIKey: ZCRNLZLTEBHQQD-UHFFFAOYSA-M.
| Molecular formula | C29H23IN2Se |
|---|---|
| Molecular weight | 605.4 g/mol |
| IUPAC name | 2-[(E)-2-(9-benzylcarbazol-3-yl)ethenyl]-3-methyl-1,3-benzoselenazol-3-ium iodide |
| InChIKey | ZCRNLZLTEBHQQD-UHFFFAOYSA-M |
| SMILES | C[N+]1=C([Se]C2=CC=CC=C21)/C=C/C3=CC4=C(C=C3)N(C5=CC=CC=C54)CC6=CC=CC=C6.[I-] |
Computed by PubChem (NCBI)