CAS 2830213-53-9 is the registry number for BRCA2-RAD51-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(3-bromophenyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (CAS 2830213-53-9) is a chemical compound with the molecular formula C13H7BrF3N3O and a molecular weight of 358.11 g/mol. IUPAC name: 5-(3-bromophenyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one. InChIKey: MYALXKFAMHOEOD-UHFFFAOYSA-N.
| Molecular formula | C13H7BrF3N3O |
|---|---|
| Molecular weight | 358.11 g/mol |
| IUPAC name | 5-(3-bromophenyl)-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| InChIKey | MYALXKFAMHOEOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CC(=O)N3C(=N2)C=C(N3)C(F)(F)F |
Computed by PubChem (NCBI)