CAS 2830214-77-0 appears in our catalog under these names: Mal–PEG3–NH2 TFA, Mal-PEG3-NH2 TFA 95%, 1-(2-(2-(2-(2-Aminoethoxy)ethoxy)ethoxy)ethyl)-1H-pyrrole-2,5-dione 2,2,2-trifluoroacetate, 98%, 98%, Mal-PEG3-NH2 (TFA), 99.07%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg, 250mg, 1g, 5g.
1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid (CAS 2830214-77-0) is a chemical compound with the molecular formula C14H21F3N2O7 and a molecular weight of 386.32 g/mol. IUPAC name: 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid. InChIKey: XJFZSMGECVGGCF-UHFFFAOYSA-N.
| Molecular formula | C14H21F3N2O7 |
|---|---|
| Molecular weight | 386.32 g/mol |
| IUPAC name | 1-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione;2,2,2-trifluoroacetic acid |
| InChIKey | XJFZSMGECVGGCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)