CAS 2831861-00-6 is the registry number for Afatinib Impurity 60. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-chloro-4-fluorophenyl)-7-fluoro-8-nitroquinazolin-4-amine (CAS 2831861-00-6) is a chemical compound with the molecular formula C14H7ClF2N4O2 and a molecular weight of 336.68 g/mol. IUPAC name: N-(3-chloro-4-fluorophenyl)-7-fluoro-8-nitroquinazolin-4-amine. InChIKey: XFNAFXIABOVZSE-UHFFFAOYSA-N.
| Molecular formula | C14H7ClF2N4O2 |
|---|---|
| Molecular weight | 336.68 g/mol |
| IUPAC name | N-(3-chloro-4-fluorophenyl)-7-fluoro-8-nitroquinazolin-4-amine |
| InChIKey | XFNAFXIABOVZSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC2=NC=NC3=C2C=CC(=C3[N+](=O)[O-])F)Cl)F |
Computed by PubChem (NCBI)