Products 2832155-52-7

CAS 2832155-52-7 is the registry number for HYOU1-IN-1, 98.32%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 100 mg, 10 mg, 5 mg, 50 mg.

Structural formula: {0} (CAS {1})

4-amino-5-chloro-N-[[1-(4-chloroanilino)cycloheptyl]methyl]-2-methoxybenzamide (CAS 2832155-52-7) is a chemical compound with the molecular formula C22H27Cl2N3O2 and a molecular weight of 436.4 g/mol. IUPAC name: 4-amino-5-chloro-N-[[1-(4-chloroanilino)cycloheptyl]methyl]-2-methoxybenzamide. InChIKey: MEQAPDRAEFUGHA-UHFFFAOYSA-N.

Identity
Molecular formulaC22H27Cl2N3O2
Molecular weight436.4 g/mol
IUPAC name4-amino-5-chloro-N-[[1-(4-chloroanilino)cycloheptyl]methyl]-2-methoxybenzamide
InChIKeyMEQAPDRAEFUGHA-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1C(=O)NCC2(CCCCCC2)NC3=CC=C(C=C3)Cl)Cl)N

Computed by PubChem (NCBI)

Synonyms: orb2565987