CAS 2834080-78-1 is the registry number for 4-Chloro-9-iodo-5,11-dihydrobenzo[b]pyrido[2,3-e][1,4]oxazepine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-9-iodo-5,11-dihydropyrido[3,2-c][1,5]benzoxazepine (CAS 2834080-78-1) is a chemical compound with the molecular formula C12H8ClIN2O and a molecular weight of 358.56 g/mol. IUPAC name: 4-chloro-9-iodo-5,11-dihydropyrido[3,2-c][1,5]benzoxazepine. InChIKey: HOMJXMCYTUWCCG-UHFFFAOYSA-N.
| Molecular formula | C12H8ClIN2O |
|---|---|
| Molecular weight | 358.56 g/mol |
| IUPAC name | 4-chloro-9-iodo-5,11-dihydropyrido[3,2-c][1,5]benzoxazepine |
| InChIKey | HOMJXMCYTUWCCG-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CN=C2NC3=C(O1)C=CC(=C3)I)Cl |
Computed by PubChem (NCBI)