CAS 2835577-98-3 is the registry number for Potassium (1-(tert-butoxycarbonyl)-2-oxopiperidin-4-yl)trifluoroborate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperidin-4-yl]boranuide (CAS 2835577-98-3) is a chemical compound with the molecular formula C10H16BF3KNO3 and a molecular weight of 305.15 g/mol. IUPAC name: potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperidin-4-yl]boranuide. InChIKey: JSEFPQSXRXGIGO-UHFFFAOYSA-N.
| Molecular formula | C10H16BF3KNO3 |
|---|---|
| Molecular weight | 305.15 g/mol |
| IUPAC name | potassium trifluoro-[1-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperidin-4-yl]boranuide |
| InChIKey | JSEFPQSXRXGIGO-UHFFFAOYSA-N |
| SMILES | [B-](C1CCN(C(=O)C1)C(=O)OC(C)(C)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)