Products 283585-02-4
CAS 283585-02-4 is the registry number for 3-Hydroxy Tolperisone Maleate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
(Z)-but-2-enedioic acid;1-(3-hydroxy-4-methylphenyl)-2-methyl-3-piperidin-1-ylpropan-1-one (CAS 283585-02-4) is a chemical compound with the molecular formula C20H27NO6 and a molecular weight of 377.4 g/mol. IUPAC name: (Z)-but-2-enedioic acid;1-(3-hydroxy-4-methylphenyl)-2-methyl-3-piperidin-1-ylpropan-1-one. InChIKey: LBIPWJFYYZEVQC-BTJKTKAUSA-N.
| Molecular formula | C20H27NO6 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;1-(3-hydroxy-4-methylphenyl)-2-methyl-3-piperidin-1-ylpropan-1-one |
| InChIKey | LBIPWJFYYZEVQC-BTJKTKAUSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C(C)CN2CCCCC2)O.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Hydroxy Tolperisone Maleate