CAS 2836225-92-2 is the registry number for 6-Fluoro-7-iodochromane-8-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-fluoro-7-iodo-3,4-dihydro-2H-chromene-8-carbonitrile (CAS 2836225-92-2) is a chemical compound with the molecular formula C10H7FINO and a molecular weight of 303.07 g/mol. IUPAC name: 6-fluoro-7-iodo-3,4-dihydro-2H-chromene-8-carbonitrile. InChIKey: QCXBOFQJVYADGS-UHFFFAOYSA-N.
| Molecular formula | C10H7FINO |
|---|---|
| Molecular weight | 303.07 g/mol |
| IUPAC name | 6-fluoro-7-iodo-3,4-dihydro-2H-chromene-8-carbonitrile |
| InChIKey | QCXBOFQJVYADGS-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C(=C2OC1)C#N)I)F |
Computed by PubChem (NCBI)