Products 2837903-52-1

CAS 2837903-52-1 is the registry number for 3,6,8-Trichloropyrimido[5,4-c]pyridazine, 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

3,6,8-trichloropyrimido[5,4-c]pyridazine (CAS 2837903-52-1) is a chemical compound with the molecular formula C6HCl3N4 and a molecular weight of 235.5 g/mol. IUPAC name: 3,6,8-trichloropyrimido[5,4-c]pyridazine. InChIKey: CZNABDAFUOJTRU-UHFFFAOYSA-N.

Identity
Molecular formulaC6HCl3N4
Molecular weight235.5 g/mol
IUPAC name3,6,8-trichloropyrimido[5,4-c]pyridazine
InChIKeyCZNABDAFUOJTRU-UHFFFAOYSA-N
SMILESC1=C2C(=NN=C1Cl)C(=NC(=N2)Cl)Cl

Computed by PubChem (NCBI)