CAS 2837903-52-1 is the registry number for 3,6,8-Trichloropyrimido[5,4-c]pyridazine, 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: 250mg, 100mg, 1g.
3,6,8-trichloropyrimido[5,4-c]pyridazine (CAS 2837903-52-1) is a chemical compound with the molecular formula C6HCl3N4 and a molecular weight of 235.5 g/mol. IUPAC name: 3,6,8-trichloropyrimido[5,4-c]pyridazine. InChIKey: CZNABDAFUOJTRU-UHFFFAOYSA-N.
| Molecular formula | C6HCl3N4 |
|---|---|
| Molecular weight | 235.5 g/mol |
| IUPAC name | 3,6,8-trichloropyrimido[5,4-c]pyridazine |
| InChIKey | CZNABDAFUOJTRU-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NN=C1Cl)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)