CAS 2838106-20-8 is the registry number for 4-Methoxy-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methoxy-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2838106-20-8) is a chemical compound with the molecular formula C11H19BN2O3 and a molecular weight of 238.09 g/mol. IUPAC name: 4-methoxy-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: APHOJKGKTXRHOO-UHFFFAOYSA-N.
| Molecular formula | C11H19BN2O3 |
|---|---|
| Molecular weight | 238.09 g/mol |
| IUPAC name | 4-methoxy-1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | APHOJKGKTXRHOO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C=C2OC)C |
Computed by PubChem (NCBI)