CAS 2839447-07-1 is the registry number for Duazomycin (sodium), 99.11%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 100 mg, 50 mg, 10 mg.
Sodium (2S)-2-acetamido-6-diazo-5-oxohexanoate (CAS 2839447-07-1) is a chemical compound with the molecular formula C8H10N3NaO4 and a molecular weight of 235.17 g/mol. IUPAC name: sodium (2S)-2-acetamido-6-diazo-5-oxohexanoate. InChIKey: NEKRLCQMGGVAPW-FJXQXJEOSA-M.
| Molecular formula | C8H10N3NaO4 |
|---|---|
| Molecular weight | 235.17 g/mol |
| IUPAC name | sodium (2S)-2-acetamido-6-diazo-5-oxohexanoate |
| InChIKey | NEKRLCQMGGVAPW-FJXQXJEOSA-M |
| SMILES | CC(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)