CAS 2839464-02-5 is the registry number for Myosin-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]-3-(oxan-4-yl)-1H-1,3,5-triazine-2,4-dione (CAS 2839464-02-5) is a chemical compound with the molecular formula C16H18F2N4O3 and a molecular weight of 352.34 g/mol. IUPAC name: 6-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]-3-(oxan-4-yl)-1H-1,3,5-triazine-2,4-dione. InChIKey: XDTGZAPJARZCOH-VIFPVBQESA-N.
| Molecular formula | C16H18F2N4O3 |
|---|---|
| Molecular weight | 352.34 g/mol |
| IUPAC name | 6-[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]-3-(oxan-4-yl)-1H-1,3,5-triazine-2,4-dione |
| InChIKey | XDTGZAPJARZCOH-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)F)F)NC2=NC(=O)N(C(=O)N2)C3CCOCC3 |
Computed by PubChem (NCBI)