Products 2839486-73-4
CAS 2839486-73-4 is the registry number for 1-(benzyloxy)-3-bromo-5-(tert-butyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-3-tert-butyl-5-phenylmethoxybenzene (CAS 2839486-73-4) is a chemical compound with the molecular formula C17H19BrO and a molecular weight of 319.2 g/mol. IUPAC name: 1-bromo-3-tert-butyl-5-phenylmethoxybenzene. InChIKey: IHHMGPXARMUIBM-UHFFFAOYSA-N.
| Molecular formula | C17H19BrO |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 1-bromo-3-tert-butyl-5-phenylmethoxybenzene |
| InChIKey | IHHMGPXARMUIBM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)Br)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)