CAS 2839502-26-8 is the registry number for 1-(tert-Butyl) 3-methyl 7-chloro-1H-pyrazolo[4,3-d]pyrimidine-1,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 3-O-methyl 7-chloropyrazolo[4,5-d]pyrimidine-1,3-dicarboxylate (CAS 2839502-26-8) is a chemical compound with the molecular formula C12H13ClN4O4 and a molecular weight of 312.71 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 7-chloropyrazolo[4,5-d]pyrimidine-1,3-dicarboxylate. InChIKey: PQMHBHHADZNEMW-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN4O4 |
|---|---|
| Molecular weight | 312.71 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 7-chloropyrazolo[4,5-d]pyrimidine-1,3-dicarboxylate |
| InChIKey | PQMHBHHADZNEMW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C(=N1)C(=O)OC)N=CN=C2Cl |
Computed by PubChem (NCBI)