CAS 2839502-29-1 is the registry number for 4-Chlorothieno[3,2-d]pyrimidin-7-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chlorothieno[3,2-d]pyrimidin-7-amine (CAS 2839502-29-1) is a chemical compound with the molecular formula C6H4ClN3S and a molecular weight of 185.64 g/mol. IUPAC name: 4-chlorothieno[3,2-d]pyrimidin-7-amine. InChIKey: ZQJCIISVJUZNKZ-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3S |
|---|---|
| Molecular weight | 185.64 g/mol |
| IUPAC name | 4-chlorothieno[3,2-d]pyrimidin-7-amine |
| InChIKey | ZQJCIISVJUZNKZ-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=NC=N2)Cl)N |
Computed by PubChem (NCBI)