CAS 2839742-60-6 is the registry number for 9,10-bis(6-phenylpyridin-3-yl)anthracene, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-bromo-4-cyclopropyl-6-(trifluoromethyl)pyrimidine (CAS 2839742-60-6) is a chemical compound with the molecular formula C8H6BrF3N2 and a molecular weight of 267.05 g/mol. IUPAC name: 5-bromo-4-cyclopropyl-6-(trifluoromethyl)pyrimidine. InChIKey: OEDABGKTLOITBP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3N2 |
|---|---|
| Molecular weight | 267.05 g/mol |
| IUPAC name | 5-bromo-4-cyclopropyl-6-(trifluoromethyl)pyrimidine |
| InChIKey | OEDABGKTLOITBP-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C(=NC=N2)C(F)(F)F)Br |
Computed by PubChem (NCBI)