CAS 2839928-09-3 is the registry number for 4-(2,4-Dinitrophenyl)morpholin-3-one. Offered by: TRC. Available pack sizes: 100mg, 10g.
4-(2,4-dinitrophenyl)morpholin-3-one (CAS 2839928-09-3) is a chemical compound with the molecular formula C10H9N3O6 and a molecular weight of 267.19 g/mol. IUPAC name: 4-(2,4-dinitrophenyl)morpholin-3-one. InChIKey: IAAJLYBNFQNYPH-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O6 |
|---|---|
| Molecular weight | 267.19 g/mol |
| IUPAC name | 4-(2,4-dinitrophenyl)morpholin-3-one |
| InChIKey | IAAJLYBNFQNYPH-UHFFFAOYSA-N |
| SMILES | C1COCC(=O)N1C2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)