CAS 284030-47-3 is the registry number for PD-254552. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(cyclopropylmethoxy)-7-fluoro-6-(4-iodo-2-methylanilino)-3H-benzimidazole-5-carboxamide (CAS 284030-47-3) is a chemical compound with the molecular formula C19H18FIN4O2 and a molecular weight of 480.3 g/mol. IUPAC name: N-(cyclopropylmethoxy)-7-fluoro-6-(4-iodo-2-methylanilino)-3H-benzimidazole-5-carboxamide. InChIKey: OVTQTDSDLSDPJL-UHFFFAOYSA-N.
| Molecular formula | C19H18FIN4O2 |
|---|---|
| Molecular weight | 480.3 g/mol |
| IUPAC name | N-(cyclopropylmethoxy)-7-fluoro-6-(4-iodo-2-methylanilino)-3H-benzimidazole-5-carboxamide |
| InChIKey | OVTQTDSDLSDPJL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)I)NC2=C(C3=C(C=C2C(=O)NOCC4CC4)NC=N3)F |
Computed by PubChem (NCBI)