CAS 2840558-83-8 appears in our catalog under these names: Aurora Kinases–IN–3, Aurora kinase-IN-3, 98.47%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 25 mg, 10 mg, 100 mg, 50 mg, 5 mg.
3-[[3-(2-methoxy-4-pyridinyl)-2-pyridinyl]oxy]-N-methyl-5-(trifluoromethoxy)benzamide (CAS 2840558-83-8) is a chemical compound with the molecular formula C20H16F3N3O4 and a molecular weight of 419.4 g/mol. IUPAC name: 3-[[3-(2-methoxy-4-pyridinyl)-2-pyridinyl]oxy]-N-methyl-5-(trifluoromethoxy)benzamide. InChIKey: NVMJCTQSUKIXBG-UHFFFAOYSA-N.
| Molecular formula | C20H16F3N3O4 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | 3-[[3-(2-methoxy-4-pyridinyl)-2-pyridinyl]oxy]-N-methyl-5-(trifluoromethoxy)benzamide |
| InChIKey | NVMJCTQSUKIXBG-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CC(=C1)OC(F)(F)F)OC2=C(C=CC=N2)C3=CC(=NC=C3)OC |
Computed by PubChem (NCBI)