Products 2840636-45-3
CAS 2840636-45-3 is the registry number for (1R,2R,4S)-2-Fluoro-4-(hydroxymethyl)cyclohexan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R,4S)-2-fluoro-4-(hydroxymethyl)cyclohexan-1-ol (CAS 2840636-45-3) is a chemical compound with the molecular formula C7H13FO2 and a molecular weight of 148.18 g/mol. IUPAC name: (1R,2R,4S)-2-fluoro-4-(hydroxymethyl)cyclohexan-1-ol. InChIKey: UTCAXMBVFOKNSR-RRKCRQDMSA-N.
| Molecular formula | C7H13FO2 |
|---|---|
| Molecular weight | 148.18 g/mol |
| IUPAC name | (1R,2R,4S)-2-fluoro-4-(hydroxymethyl)cyclohexan-1-ol |
| InChIKey | UTCAXMBVFOKNSR-RRKCRQDMSA-N |
| SMILES | C1C[C@H]([C@@H](C[C@H]1CO)F)O |
Computed by PubChem (NCBI)