Products 2841308-96-9
CAS 2841308-96-9 appears in our catalog under these names: PROTAC AR/AR–V7 degrader–1, PROTAC AR/AR-V7 degrader-1, 99.72%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 5 mg, 50 mg, 25 mg, 10 mg, 100 mg.
4-[3-[2-[(8-fluoroquinolin-5-yl)amino]ethyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (CAS 2841308-96-9) is a chemical compound with the molecular formula C24H19F4N5O2 and a molecular weight of 485.4 g/mol. IUPAC name: 4-[3-[2-[(8-fluoroquinolin-5-yl)amino]ethyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile. InChIKey: QMRZVTDYXXBISG-UHFFFAOYSA-N.
| Molecular formula | C24H19F4N5O2 |
|---|---|
| Molecular weight | 485.4 g/mol |
| IUPAC name | 4-[3-[2-[(8-fluoroquinolin-5-yl)amino]ethyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| InChIKey | QMRZVTDYXXBISG-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)N1CCNC2=C3C=CC=NC3=C(C=C2)F)C4=CC(=C(C=C4)C#N)C(F)(F)F)C |
Computed by PubChem (NCBI)
Synonyms:
PROTAC AR/AR-V7 degrader-1, orb2565428