Products 2841405-96-5
CAS 2841405-96-5 is the registry number for EGFR/CDK2-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-1-(4-bromophenyl)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-en-1-one (CAS 2841405-96-5) is a chemical compound with the molecular formula C19H12BrClO2 and a molecular weight of 387.7 g/mol. IUPAC name: (E)-1-(4-bromophenyl)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-en-1-one. InChIKey: YIOGDNXXYFSGJY-PKNBQFBNSA-N.
| Molecular formula | C19H12BrClO2 |
|---|---|
| Molecular weight | 387.7 g/mol |
| IUPAC name | (E)-1-(4-bromophenyl)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-en-1-one |
| InChIKey | YIOGDNXXYFSGJY-PKNBQFBNSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(O2)/C=C/C(=O)C3=CC=C(C=C3)Br)Cl |
Computed by PubChem (NCBI)