CAS 2841467-86-3 is the registry number for IDO1-IN-25. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,6-dichloro-2-[(4-chlorophenyl)methylsulfinyl]-1,3-benzoxazole (CAS 2841467-86-3) is a chemical compound with the molecular formula C14H8Cl3NO2S and a molecular weight of 360.6 g/mol. IUPAC name: 5,6-dichloro-2-[(4-chlorophenyl)methylsulfinyl]-1,3-benzoxazole. InChIKey: QMHPTJIYGUAXKF-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl3NO2S |
|---|---|
| Molecular weight | 360.6 g/mol |
| IUPAC name | 5,6-dichloro-2-[(4-chlorophenyl)methylsulfinyl]-1,3-benzoxazole |
| InChIKey | QMHPTJIYGUAXKF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)C2=NC3=CC(=C(C=C3O2)Cl)Cl)Cl |
Computed by PubChem (NCBI)