Products 2841519-83-1
CAS 2841519-83-1 is the registry number for N,N-Bis(Boc)imidazo[1,2-a]pyrazin-6-amine, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl N-imidazo[1,2-a]pyrazin-6-yl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 2841519-83-1) is a chemical compound with the molecular formula C16H22N4O4 and a molecular weight of 334.37 g/mol. IUPAC name: tert-butyl N-imidazo[1,2-a]pyrazin-6-yl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: SMQURWREQZWUQH-UHFFFAOYSA-N.
| Molecular formula | C16H22N4O4 |
|---|---|
| Molecular weight | 334.37 g/mol |
| IUPAC name | tert-butyl N-imidazo[1,2-a]pyrazin-6-yl-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | SMQURWREQZWUQH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=CN2C=CN=C2C=N1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)