Products 28424-61-5

CAS 28424-61-5 is the registry number for (2E)-3-(2-Thienyl)acryloyl chloride, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(E)-3-thiophen-2-ylprop-2-enoyl chloride (CAS 28424-61-5) is a chemical compound with the molecular formula C7H5ClOS and a molecular weight of 172.63 g/mol. IUPAC name: (E)-3-thiophen-2-ylprop-2-enoyl chloride. InChIKey: KKPKHEMQDJRRIE-ONEGZZNKSA-N.

Identity
Molecular formulaC7H5ClOS
Molecular weight172.63 g/mol
IUPAC name(E)-3-thiophen-2-ylprop-2-enoyl chloride
InChIKeyKKPKHEMQDJRRIE-ONEGZZNKSA-N
SMILESC1=CSC(=C1)/C=C/C(=O)Cl

Computed by PubChem (NCBI)