Products 2842847-23-6
CAS 2842847-23-6 is the registry number for Nitro-coronene. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,4,7,10-tetranitrocoronene (CAS 2842847-23-6) is a chemical compound with the molecular formula C24H8N4O8 and a molecular weight of 480.3 g/mol. IUPAC name: 1,4,7,10-tetranitrocoronene. InChIKey: DBUINGGNHCNGHI-UHFFFAOYSA-N.
| Molecular formula | C24H8N4O8 |
|---|---|
| Molecular weight | 480.3 g/mol |
| IUPAC name | 1,4,7,10-tetranitrocoronene |
| InChIKey | DBUINGGNHCNGHI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C4=C1C(=CC5=CC(=C6C=CC7=C(C=C(C3=C7C6=C54)C=C2[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Nitro-coronene, orb1943094