Products 28434-74-4
CAS 28434-74-4 is the registry number for Bumetanide (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate (CAS 28434-74-4) is a chemical compound with the molecular formula C17H19N2NaO5S and a molecular weight of 386.4 g/mol. IUPAC name: sodium 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate. InChIKey: QDFGOJHAQZEYQL-UHFFFAOYSA-M.
| Molecular formula | C17H19N2NaO5S |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | sodium 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
| InChIKey | QDFGOJHAQZEYQL-UHFFFAOYSA-M |
| SMILES | CCCCNC1=C(C(=CC(=C1)C(=O)[O-])S(=O)(=O)N)OC2=CC=CC=C2.[Na+] |
Computed by PubChem (NCBI)