Products 2844396-80-9
CAS 2844396-80-9 is the registry number for 5-Bromo-2-(4-methoxybenzyl)phthalazin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-[(4-methoxyphenyl)methyl]phthalazin-1-one (CAS 2844396-80-9) is a chemical compound with the molecular formula C16H13BrN2O2 and a molecular weight of 345.19 g/mol. IUPAC name: 5-bromo-2-[(4-methoxyphenyl)methyl]phthalazin-1-one. InChIKey: MSPDPVVHQOOXNM-UHFFFAOYSA-N.
| Molecular formula | C16H13BrN2O2 |
|---|---|
| Molecular weight | 345.19 g/mol |
| IUPAC name | 5-bromo-2-[(4-methoxyphenyl)methyl]phthalazin-1-one |
| InChIKey | MSPDPVVHQOOXNM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(=O)C3=C(C=N2)C(=CC=C3)Br |
Computed by PubChem (NCBI)