CAS 284464-83-1 is the registry number for BM-573. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-tert-butyl-3-[2-(4-methylanilino)-5-nitrophenyl]sulfonylurea (CAS 284464-83-1) is a chemical compound with the molecular formula C18H22N4O5S and a molecular weight of 406.5 g/mol. IUPAC name: 1-tert-butyl-3-[2-(4-methylanilino)-5-nitrophenyl]sulfonylurea. InChIKey: SILRUCMXYIKULW-UHFFFAOYSA-N.
| Molecular formula | C18H22N4O5S |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | 1-tert-butyl-3-[2-(4-methylanilino)-5-nitrophenyl]sulfonylurea |
| InChIKey | SILRUCMXYIKULW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=C(C=C(C=C2)[N+](=O)[O-])S(=O)(=O)NC(=O)NC(C)(C)C |
Computed by PubChem (NCBI)